|
CAS#: 55490-03-4 Product: 2-Bromo-2-[(4-Methylphenyl)Sulphonyl]Acetamide No suppilers available for the product. |
| Name | 2-Bromo-2-[(4-Methylphenyl)Sulphonyl]Acetamide |
|---|---|
| Synonyms | 2-Bromo-2-(4-Methylphenyl)Sulfonyl-Acetamide; 2-Bromo-2-(4-Methylphenyl)Sulfonyl-Ethanamide; 2-Bromo-2-((4-Methylphenyl)Sulphonyl)Acetamide |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10BrNO3S |
| Molecular Weight | 292.15 |
| CAS Registry Number | 55490-03-4 |
| EINECS | 259-672-0 |
| SMILES | C1=CC(=CC=C1[S](C(Br)C(=O)N)(=O)=O)C |
| InChI | 1S/C9H10BrNO3S/c1-6-2-4-7(5-3-6)15(13,14)8(10)9(11)12/h2-5,8H,1H3,(H2,11,12) |
| InChIKey | WLSZSLYALIHGPS-UHFFFAOYSA-N |
| Density | 1.638g/cm3 (Cal.) |
|---|---|
| Boiling point | 457.284°C at 760 mmHg (Cal.) |
| Flash point | 230.358°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Bromo-2-[(4-Methylphenyl)Sulphonyl]Acetamide |