Online Database of Chemicals from Around the World
|
CAS#: 55592-99-9 Product: 4-(Phenylazo)Benzyl Chloroformate No suppilers available for the product. |
| Name | 4-(Phenylazo)Benzyl Chloroformate |
|---|---|
| Synonyms | (4-Phenylazophenyl)Methyl Chloroformate; Chloroformic Acid (4-Phenylazophenyl)Methyl Ester; Chloroformic Acid (4-Phenylazobenzyl) Ester |
| Molecular Structure |  |
| Molecular Formula | C14H11ClN2O2 |
| Molecular Weight | 274.71 |
| CAS Registry Number | 55592-99-9 |
| EINECS | 259-719-5 |
| SMILES | C2=C(N=NC1=CC=CC=C1)C=CC(=C2)COC(Cl)=O |
| InChI | 1S/C14H11ClN2O2/c15-14(18)19-10-11-6-8-13(9-7-11)17-16-12-4-2-1-3-5-12/h1-9H,10H2 |
| InChIKey | SBPAKMOTHPSGDZ-UHFFFAOYSA-N |
| Density | 1.229g/cm3 (Cal.) |
|---|---|
| Boiling point | 402.768°C at 760 mmHg (Cal.) |
| Flash point | 197.387°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Phenylazo)Benzyl Chloroformate |