|
CAS#: 55600-34-5 Product: 3,3'-Dichloro-1,1'-biphenyl No suppilers available for the product. |
| Name | 3,3'-Dichloro-1,1'-biphenyl |
|---|---|
| Synonyms | Clophen A 30; Inchi=1/C12h8cl2/C13-11-5-1-3-9(7-11)10-4-2-6-12(14)8-10/H1-8; 1,1'-Biphenyl, 3,3'-Dichloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8Cl2 |
| Molecular Weight | 223.10 |
| CAS Registry Number | 55600-34-5 |
| SMILES | C2=C(C1=CC(=CC=C1)Cl)C=CC=C2Cl |
| InChI | 1S/C12H8Cl2/c13-11-5-1-3-9(7-11)10-4-2-6-12(14)8-10/h1-8H |
| InChIKey | KTXUOWUHFLBZPW-UHFFFAOYSA-N |
| Density | 1.249g/cm3 (Cal.) |
|---|---|
| Boiling point | 324.744°C at 760 mmHg (Cal.) |
| Flash point | 150.532°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3'-Dichloro-1,1'-biphenyl |