|
CAS#: 55730-89-7 Product: 5-(2,2,3-Trimethyl-3-Cyclopenten-1-Yl)Pent-4-En-2-One No suppilers available for the product. |
| Name | 5-(2,2,3-Trimethyl-3-Cyclopenten-1-Yl)Pent-4-En-2-One |
|---|---|
| Synonyms | (E)-5-(2,2,3-Trimethyl-1-Cyclopent-3-Enyl)Pent-4-En-2-One; 4-Penten-2-One, 5-(2,2,3-Trimethyl-3-Cyclopenten-1-Yl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 |
| CAS Registry Number | 55730-89-7 |
| EINECS | 259-781-3 |
| SMILES | C(/C=C/C1C(C(=CC1)C)(C)C)C(=O)C |
| InChI | 1S/C13H20O/c1-10-8-9-12(13(10,3)4)7-5-6-11(2)14/h5,7-8,12H,6,9H2,1-4H3/b7-5+ |
| InChIKey | BLZZNBSCWYINFA-FNORWQNLSA-N |
| Density | 0.941g/cm3 (Cal.) |
|---|---|
| Boiling point | 266.557°C at 760 mmHg (Cal.) |
| Flash point | 95.178°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(2,2,3-Trimethyl-3-Cyclopenten-1-Yl)Pent-4-En-2-One |