|
CAS#: 55869-01-7 Product: Sodium Methyl (2,2,2-Trichloro-1-Hydroxyethyl)Phosphonate No suppilers available for the product. |
| Name | Sodium Methyl (2,2,2-Trichloro-1-Hydroxyethyl)Phosphonate |
|---|---|
| Synonyms | Desmethyl-trichlorphon |
| Molecular Structure | ![]() |
| Molecular Formula | C3H5Cl3NaO4P |
| Molecular Weight | 265.39 |
| CAS Registry Number | 55869-01-7 |
| SMILES | [Na+].ClC(Cl)(Cl)C(O)P([O-])(=O)OC |
| InChI | 1S/C3H6Cl3O4P.Na/c1-10-11(8,9)2(7)3(4,5)6;/h2,7H,1H3,(H,8,9);/q;+1/p-1 |
| InChIKey | ZTFYIGDRNBAICX-UHFFFAOYSA-M |
| Boiling point | 285.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 126.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium Methyl (2,2,2-Trichloro-1-Hydroxyethyl)Phosphonate |