|
CAS#: 55915-30-5 Product: 1,4-Diphenyl-3-(Phenylamino)-1H-1,2,4-Triazolium Bromide No suppilers available for the product. |
| Name | 1,4-Diphenyl-3-(Phenylamino)-1H-1,2,4-Triazolium Bromide |
|---|---|
| Synonyms | 2,3,5,6-Tetraazabicyclo(2.1.1)Hex-1-Ene, 3,5,6-Triphenyl-, Monohydrobromide |
| Molecular Structure | ![]() |
| Molecular Formula | C20H19BrN4 |
| Molecular Weight | 395.30 |
| CAS Registry Number | 55915-30-5 |
| SMILES | [H+].C4=C(N1CN(N=C1NC2=CC=CC=C2)C3=CC=CC=C3)C=CC=C4.[Br-] |
| InChI | 1S/C20H18N4.BrH/c1-4-10-17(11-5-1)21-20-22-24(19-14-8-3-9-15-19)16-23(20)18-12-6-2-7-13-18;/h1-15H,16H2,(H,21,22);1H |
| InChIKey | UFARRNXGEDNDGL-UHFFFAOYSA-N |
| Boiling point | 447.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 224.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Diphenyl-3-(Phenylamino)-1H-1,2,4-Triazolium Bromide |