|
CAS#: 56071-60-4 Product: 2-Methyl-1,5-Diphenyl-1H-Pyrrole-3,4-Dicarboxylic Acid Dimethyl Ester No suppilers available for the product. |
| Name | 2-Methyl-1,5-Diphenyl-1H-Pyrrole-3,4-Dicarboxylic Acid Dimethyl Ester |
|---|---|
| Synonyms | 2-Methyl-1,5-Di(Phenyl)Pyrrole-3,4-Dicarboxylic Acid Dimethyl Ester; Pyrrole-3,4-Dicarboxylic Acid, 2-Methyl-1,5-Diphenyl-, Dimethyl Ester; 1H-Pyrrole-3,4-Dicarboxylic Acid, 2-Methyl-1,5-Diphenyl-, Dimethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C21H19NO4 |
| Molecular Weight | 349.39 |
| CAS Registry Number | 56071-60-4 |
| SMILES | C3=C([N]1C(=C(C(=C1C)C(=O)OC)C(=O)OC)C2=CC=CC=C2)C=CC=C3 |
| InChI | 1S/C21H19NO4/c1-14-17(20(23)25-2)18(21(24)26-3)19(15-10-6-4-7-11-15)22(14)16-12-8-5-9-13-16/h4-13H,1-3H3 |
| InChIKey | NOIRBDMFBKMFQC-UHFFFAOYSA-N |
| Density | 1.162g/cm3 (Cal.) |
|---|---|
| Boiling point | 494.596°C at 760 mmHg (Cal.) |
| Flash point | 252.923°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-1,5-Diphenyl-1H-Pyrrole-3,4-Dicarboxylic Acid Dimethyl Ester |