|
CAS#: 56085-36-0 Product: 3alpha-(Acetyloxy)Cholan-24-Oic Acid Methyl Ester No suppilers available for the product. |
| Name | 3alpha-(Acetyloxy)Cholan-24-Oic Acid Methyl Ester |
|---|---|
| Synonyms | Methyl 4-(3-Acetoxy-10,13-Dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-Tetradecahydro-1H-Cyclopenta[A]Phenanthren-17-Yl)Pentanoate; 4-(3-Acetoxy-10,13-Dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-Tetradecahydro-1H-Cyclopenta[A]Phenanthren-17-Yl)Pentanoic Acid Methyl Ester; 4-(3-Acetoxy-10,13-Dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-Tetradecahydro-1H-Cyclopenta[A]Phenanthren-17-Yl)Valeric Acid Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C27H44O4 |
| Molecular Weight | 432.64 |
| CAS Registry Number | 56085-36-0 |
| SMILES | C(C(C4C3(C(C1C(C2(C(CC1)CC(OC(=O)C)CC2)C)CC3)CC4)C)C)CC(OC)=O |
| InChI | 1S/C27H44O4/c1-17(6-11-25(29)30-5)22-9-10-23-21-8-7-19-16-20(31-18(2)28)12-14-26(19,3)24(21)13-15-27(22,23)4/h17,19-24H,6-16H2,1-5H3 |
| InChIKey | DVIUCIPCTDVQAP-UHFFFAOYSA-N |
| Density | 1.064g/cm3 (Cal.) |
|---|---|
| Boiling point | 487.482°C at 760 mmHg (Cal.) |
| Flash point | 230.679°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3alpha-(Acetyloxy)Cholan-24-Oic Acid Methyl Ester |