|
CAS#: 56092-63-8 Product: Verruculotoxin No suppilers available for the product. |
| Name | Verruculotoxin |
|---|---|
| Synonyms | (3S,9As)-3-(Benzyl)-2,3,4,6,7,8,9,9A-Octahydropyrido[2,1-C]Pyrazin-1-One; C10624; Verruculotoxin |
| Molecular Structure | ![]() |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 |
| CAS Registry Number | 56092-63-8 |
| SMILES | [C@H]12C(N[C@H](CN1CCCC2)CC3=CC=CC=C3)=O |
| InChI | 1S/C15H20N2O/c18-15-14-8-4-5-9-17(14)11-13(16-15)10-12-6-2-1-3-7-12/h1-3,6-7,13-14H,4-5,8-11H2,(H,16,18)/t13-,14-/m0/s1 |
| InChIKey | CUANCTHYEDWUMU-KBPBESRZSA-N |
| Density | 1.149g/cm3 (Cal.) |
|---|---|
| Boiling point | 436.379°C at 760 mmHg (Cal.) |
| Flash point | 217.714°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Verruculotoxin |