Online Database of Chemicals from Around the World
|
CAS#: 56103-67-4 Product: 2,6-Bis(1,1-Dimethylpropyl)-4-Methylphenol No suppilers available for the product. |
| Name | 2,6-Bis(1,1-Dimethylpropyl)-4-Methylphenol |
|---|---|
| Synonyms | 2,6-Bis(1,1-Dimethylpropyl)-4-Methyl-Phenol; 2,6-Bis(1,1-Dimethylpropyl)-4-Methylphenol; 2,6-Ditert-Amyl-4-Methyl-Phenol |
| Molecular Structure |  |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 |
| CAS Registry Number | 56103-67-4 |
| SMILES | C1=C(C(=C(C=C1C)C(CC)(C)C)O)C(CC)(C)C |
| InChI | 1S/C17H28O/c1-8-16(4,5)13-10-12(3)11-14(15(13)18)17(6,7)9-2/h10-11,18H,8-9H2,1-7H3 |
| InChIKey | SOASHAVJCWKTKL-UHFFFAOYSA-N |
| Density | 0.918g/cm3 (Cal.) |
|---|---|
| Boiling point | 282.999°C at 760 mmHg (Cal.) |
| Flash point | 134.701°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Bis(1,1-Dimethylpropyl)-4-Methylphenol |