|
CAS#: 56667-01-7 Product: 3,3',4,4',5,5'-Hexamethyl-1,1'-Biphenyl No suppilers available for the product. |
| Name | 3,3',4,4',5,5'-Hexamethyl-1,1'-Biphenyl |
|---|---|
| Synonyms | Hexamethylbiphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C18H22 |
| Molecular Weight | 238.37 |
| CAS Registry Number | 56667-01-7 |
| SMILES | C1=CC(=C(C(=C1C2=C(C(=C(C=C2)C)C)C)C)C)C |
| InChI | 1S/C18H22/c1-11-7-9-17(15(5)13(11)3)18-10-8-12(2)14(4)16(18)6/h7-10H,1-6H3 |
| InChIKey | CGEIJASJNVVERB-UHFFFAOYSA-N |
| Density | 0.945g/cm3 (Cal.) |
|---|---|
| Boiling point | 328.086°C at 760 mmHg (Cal.) |
| Flash point | 159.788°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3',4,4',5,5'-Hexamethyl-1,1'-Biphenyl |