Online Database of Chemicals from Around the World
|
CAS#: 56890-89-2 Product: 1,2,3,4,7,7-Hexachloro-5-(Tribromophenyl)Bicyclo[2.2.1]Hept-2-Ene No suppilers available for the product. |
| Name | 1,2,3,4,7,7-Hexachloro-5-(Tribromophenyl)Bicyclo[2.2.1]Hept-2-Ene |
|---|---|
| Synonyms | 1,2,3,4,7,7-Hexachloro-5-(Tribromophenyl)Bicyclo(2.2.1)Hept-2-Ene; Bicyclo(2.2.1)Hept-2-Ene, 1,2,3,4,7,7-Hexachloro-5-(Tribromophenyl)- |
| Molecular Structure | ![CAS#: 56890-89-2, 1,2,3,4,7,7-Hexachloro-5-(Tribromophenyl)Bicyclo[2.2.1]Hept-2-Ene](/moreStructures/56890-89-2.gif) |
| Molecular Formula | C13H5Br3Cl6 |
| Molecular Weight | 613.61 |
| CAS Registry Number | 56890-89-2 |
| EINECS | 260-420-7 |
| SMILES | C1=C(C(=C(C=C1Br)Br)C2CC3(C(C2(Cl)C(=C3Cl)Cl)(Cl)Cl)Cl)Br |
| InChI | 1S/C13H5Br3Cl6/c14-4-1-6(15)8(7(16)2-4)5-3-11(19)9(17)10(18)12(5,20)13(11,21)22/h1-2,5H,3H2 |
| InChIKey | MVQRAJZAYJHOAS-UHFFFAOYSA-N |
| Density | 2.275g/cm3 (Cal.) |
|---|---|
| Boiling point | 479.564°C at 760 mmHg (Cal.) |
| Flash point | 285.064°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,7,7-Hexachloro-5-(Tribromophenyl)Bicyclo[2.2.1]Hept-2-Ene |