|
CAS#: 56894-29-2 Product: 1-(3-Chloropropyl)-2-Methyl-5-Nitro-1H-Imidazole No suppilers available for the product. |
| Name | 1-(3-Chloropropyl)-2-Methyl-5-Nitro-1H-Imidazole |
|---|---|
| Synonyms | 1-(3-Chloropropyl)-2-Methyl-5-Nitro-Imidazole; 1-(3-Chloropropyl)-2-Methyl-5-Nitro-1H-Imidazole |
| Molecular Structure | ![]() |
| Molecular Formula | C7H10ClN3O2 |
| Molecular Weight | 203.63 |
| CAS Registry Number | 56894-29-2 |
| EINECS | 260-421-2 |
| SMILES | C1=C([N](C(=N1)C)CCCCl)[N+]([O-])=O |
| InChI | 1S/C7H10ClN3O2/c1-6-9-5-7(11(12)13)10(6)4-2-3-8/h5H,2-4H2,1H3 |
| InChIKey | JCQFIQJFPHTLGY-UHFFFAOYSA-N |
| Density | 1.394g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.004°C at 760 mmHg (Cal.) |
| Flash point | 184.225°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3-Chloropropyl)-2-Methyl-5-Nitro-1H-Imidazole |