|
CAS#: 56933-74-5 Product: 3-Methoxy-5,6-Secoestra-1,3,5(10),8,14-Pentaene-17-One No suppilers available for the product. |
| Name | 3-Methoxy-5,6-Secoestra-1,3,5(10),8,14-Pentaene-17-One |
|---|---|
| Synonyms | 3-Methoxy-5,6-Secoestra-1,3,5(10),8,14-Pentaene-17-One; 3-Mspo; 1H-Inden-1-One, 4-Ethyl-2,6,7,7A-Tetrahydro-5-(4-Methoxyphenyl)-7A-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 |
| CAS Registry Number | 56933-74-5 |
| SMILES | C3=C(C2=C(C1=CCC(=O)C1(CC2)C)CC)C=CC(=C3)OC |
| InChI | 1S/C19H22O2/c1-4-15-16(13-5-7-14(21-3)8-6-13)11-12-19(2)17(15)9-10-18(19)20/h5-9H,4,10-12H2,1-3H3 |
| InChIKey | PKKUZFYAFDBPQZ-UHFFFAOYSA-N |
| Density | 1.108g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.661°C at 760 mmHg (Cal.) |
| Flash point | 185.374°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methoxy-5,6-Secoestra-1,3,5(10),8,14-Pentaene-17-One |