|
CAS#: 56954-90-6 Product: 2-(9H-Fluoren-9-Yl)Propan-2-Ol No suppilers available for the product. |
| Name | 2-(9H-Fluoren-9-Yl)Propan-2-Ol |
|---|---|
| Synonyms | Nsc49729 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16O |
| Molecular Weight | 224.30 |
| CAS Registry Number | 56954-90-6 |
| SMILES | C1=CC=CC2=C1C(C3=C2C=CC=C3)C(C)(O)C |
| InChI | 1S/C16H16O/c1-16(2,17)15-13-9-5-3-7-11(13)12-8-4-6-10-14(12)15/h3-10,15,17H,1-2H3 |
| InChIKey | JVGXPNUMSYDKCO-UHFFFAOYSA-N |
| Density | 1.147g/cm3 (Cal.) |
|---|---|
| Boiling point | 371.882°C at 760 mmHg (Cal.) |
| Flash point | 158.737°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(9H-Fluoren-9-Yl)Propan-2-Ol |