|
CAS#: 5697-85-8 Product: 2-Phenethylaniline No suppilers available for the product. |
| Name | 2-Phenethylaniline |
|---|---|
| Synonyms | [2-(2-Phenylethyl)Phenyl]Amine; Nsc210905; Zinc01746581 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 |
| CAS Registry Number | 5697-85-8 |
| SMILES | C1=CC=C(C=C1)CCC2=C(C=CC=C2)N |
| InChI | 1S/C14H15N/c15-14-9-5-4-8-13(14)11-10-12-6-2-1-3-7-12/h1-9H,10-11,15H2 |
| InChIKey | WTPXECNTVYUIGM-UHFFFAOYSA-N |
| Density | 1.065g/cm3 (Cal.) |
|---|---|
| Boiling point | 320.391°C at 760 mmHg (Cal.) |
| Flash point | 154.086°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Phenethylaniline |