|
CAS#: 56974-03-9 Product: 1-(3,5,5-Trimethyl-1-Cyclohexen-1-Yl)Pent-4-En-1-One No suppilers available for the product. |
| Name | 1-(3,5,5-Trimethyl-1-Cyclohexen-1-Yl)Pent-4-En-1-One |
|---|---|
| Synonyms | 1-(3,5,5-Trimethyl-1-Cyclohexen-1-Yl)Pent-4-En-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 |
| CAS Registry Number | 56974-03-9 |
| EINECS | 260-487-2 |
| SMILES | C(C(=O)C1=CC(CC(C1)(C)C)C)CC=C |
| InChI | 1S/C14H22O/c1-5-6-7-13(15)12-8-11(2)9-14(3,4)10-12/h5,8,11H,1,6-7,9-10H2,2-4H3 |
| InChIKey | YSSPNGUMZKBWDM-UHFFFAOYSA-N |
| Density | 0.889g/cm3 (Cal.) |
|---|---|
| Boiling point | 280.036°C at 760 mmHg (Cal.) |
| Flash point | 111.764°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3,5,5-Trimethyl-1-Cyclohexen-1-Yl)Pent-4-En-1-One |