|
CAS#: 570-19-4 Product: Europine No suppilers available for the product. |
| Name | Europine |
|---|---|
| Synonyms | (7-Hydroxy-5,6,7,8-Tetrahydro-3H-Pyrrolizin-1-Yl)Methyl 2,3-Dihydroxy-2-(1-Methoxyethyl)-3-Methyl-Butanoate; 2,3-Dihydroxy-2-(1-Methoxyethyl)-3-Methylbutanoic Acid (7-Hydroxy-5,6,7,8-Tetrahydro-3H-Pyrrolizin-1-Yl)Methyl Ester; 2,3-Dihydroxy-2-(1-Methoxyethyl)-3-Methyl-Butyric Acid (7-Hydroxy-5,6,7,8-Tetrahydro-3H-Pyrrolizin-1-Yl)Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C16H27NO6 |
| Molecular Weight | 329.39 |
| CAS Registry Number | 570-19-4 |
| SMILES | C(C1=CCN2C1C(CC2)O)OC(C(C(O)(C)C)(C(OC)C)O)=O |
| InChI | 1S/C16H27NO6/c1-10(22-4)16(21,15(2,3)20)14(19)23-9-11-5-7-17-8-6-12(18)13(11)17/h5,10,12-13,18,20-21H,6-9H2,1-4H3 |
| InChIKey | ZNEMYFCJOCCUJN-UHFFFAOYSA-N |
| Density | 1.274g/cm3 (Cal.) |
|---|---|
| Boiling point | 477.073°C at 760 mmHg (Cal.) |
| Flash point | 242.325°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Europine |