|
CAS#: 57009-86-6 Product: 2-(3,4-Dimethoxyphenyl)-1,3-Dithiane 1,1,3,3-Tetraoxide No suppilers available for the product. |
| Name | 2-(3,4-Dimethoxyphenyl)-1,3-Dithiane 1,1,3,3-Tetraoxide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H16O6S2 |
| Molecular Weight | 320.37 |
| CAS Registry Number | 57009-86-6 |
| EINECS | 260-509-0 |
| SMILES | C2=C(C1[S](=O)(=O)CCC[S]1(=O)=O)C=CC(=C2OC)OC |
| InChI | 1S/C12H16O6S2/c1-17-10-5-4-9(8-11(10)18-2)12-19(13,14)6-3-7-20(12,15)16/h4-5,8,12H,3,6-7H2,1-2H3 |
| InChIKey | ODNGPQOKPLSWSJ-UHFFFAOYSA-N |
| Density | 1.382g/cm3 (Cal.) |
|---|---|
| Boiling point | 610.216°C at 760 mmHg (Cal.) |
| Flash point | 322.847°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3,4-Dimethoxyphenyl)-1,3-Dithiane 1,1,3,3-Tetraoxide |