|
CAS#: 57312-08-0 Product: 2-(3-Ethoxyphenyl)-5H-[1,2,4]Triazolo[5,1-a]Isoindole No suppilers available for the product. |
| Name | 2-(3-Ethoxyphenyl)-5H-[1,2,4]Triazolo[5,1-a]Isoindole |
|---|---|
| Synonyms | 2-(3-Ethoxyphenyl)-5H-(1,2,4)Triazolo(5,1-A)Isoindole; 2-(M-Ethoxyphenyl)-5H-S-Triazolo(5,1-A)Isoindole; 5H-(1,2,4)Triazolo(5,1-A)Isoindole, 2-(3-Ethoxyphenyl)- (9Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 |
| CAS Registry Number | 57312-08-0 |
| SMILES | C1=CC=CC3=C1C2=NC(=N[N]2C3)C4=CC(=CC=C4)OCC |
| InChI | 1S/C17H15N3O/c1-2-21-14-8-5-7-12(10-14)16-18-17-15-9-4-3-6-13(15)11-20(17)19-16/h3-10H,2,11H2,1H3 |
| InChIKey | SBCWILTVTKFYRD-UHFFFAOYSA-N |
| Density | 1.272g/cm3 (Cal.) |
|---|---|
| Boiling point | 504.674°C at 760 mmHg (Cal.) |
| Flash point | 259.018°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3-Ethoxyphenyl)-5H-[1,2,4]Triazolo[5,1-a]Isoindole |