|
CAS#: 57346-61-9 Product: 2,4,6-Trichloro-1,1':4',1''-Terbenzene No suppilers available for the product. |
| Name | 2,4,6-Trichloro-1,1':4',1''-Terbenzene |
|---|---|
| Synonyms | 2,4,6-Trichloro-P-Terphenyl; 1,1':4',1''-Terphenyl, 2,4,6-Trichloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H11Cl3 |
| Molecular Weight | 333.64 |
| CAS Registry Number | 57346-61-9 |
| SMILES | C1=C(C=C(C(=C1Cl)C2=CC=C(C=C2)C3=CC=CC=C3)Cl)Cl |
| InChI | 1S/C18H11Cl3/c19-15-10-16(20)18(17(21)11-15)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-11H |
| InChIKey | XAXACBKNRDMUDP-UHFFFAOYSA-N |
| Density | 1.304g/cm3 (Cal.) |
|---|---|
| Boiling point | 442.932°C at 760 mmHg (Cal.) |
| Flash point | 313.203°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,6-Trichloro-1,1':4',1''-Terbenzene |