|
CAS#: 57357-84-3 Product: [1S-(1alpha,2beta,3alpha,5alpha)]-Pinane-3-Methylammonium Chloride No suppilers available for the product. |
| Name | [1S-(1alpha,2beta,3alpha,5alpha)]-Pinane-3-Methylammonium Chloride |
|---|---|
| Synonyms | (1S,2S,5S)-N,2,6,6-Tetramethylnorpinan-3-Amine Hydrochloride; (1S,2S,5S)-N,2,6,6-Tetramethyl-3-Norpinanamine Hydrochloride; Methyl-[(1S,2S,5S)-2,6,6-Trimethylnorpinan-3-Yl]Amine Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C11H22ClN |
| Molecular Weight | 203.75 |
| CAS Registry Number | 57357-84-3 |
| EINECS | 260-693-2 |
| SMILES | [C@H]12C([C@@H](C1)CC(NC)[C@H]2C)(C)C.[H+].[Cl-] |
| InChI | 1S/C11H21N.ClH/c1-7-9-5-8(11(9,2)3)6-10(7)12-4;/h7-10,12H,5-6H2,1-4H3;1H/t7-,8-,9-,10?;/m0./s1 |
| InChIKey | SLBHRUVXKGEGPB-MVIKOGBFSA-N |
| Boiling point | 199.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 65.2°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for [1S-(1alpha,2beta,3alpha,5alpha)]-Pinane-3-Methylammonium Chloride |