| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | Caffeine |
|---|---|
| Synonyms | 1,3,7-Trimethylxanthine Hydrate; Caffeine (Jp15); Caffeine (Tn) |
| Molecular Structure | ![]() |
| Molecular Formula | C8H12N4O3 |
| Molecular Weight | 212.21 |
| CAS Registry Number | 5743-12-4 |
| SMILES | C1=NC2=C([N]1C)C(=O)N(C)C(=O)N2C.O |
| InChI | 1S/C8H10N4O2.H2O/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2;/h4H,1-3H3;1H2 |
| InChIKey | LCHGOKZNRDAXEK-UHFFFAOYSA-N |
| Boiling point | 416.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 205.9°C (Cal.) |
| (1) | Nate Schultheiss, Sarah Bethune and Jan-Olav Henck. Nutraceutical cocrystals: utilizing pterostilbene as a cocrystal former, CrystEngComm, 2010, 12, 2436. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Caffeine |