|
CAS#: 5779-39-5 Product: Desosamine No suppilers available for the product. |
| Name | Desosamine |
|---|---|
| Synonyms | (2R,3S,5R)-3-Dimethylamino-2,5-Dihydroxy-Hexanal; 3,4,6-Trideoxy-3-Dimethylamino-D-Xylo-Hexose; Chebi:32540 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 |
| CAS Registry Number | 5779-39-5 |
| SMILES | [C@@H](C)(C[C@@H]([C@H](C=O)O)N(C)C)O |
| InChI | 1S/C8H17NO3/c1-6(11)4-7(9(2)3)8(12)5-10/h5-8,11-12H,4H2,1-3H3/t6-,7+,8+/m1/s1 |
| InChIKey | VTJCSBJRQLZNHE-CSMHCCOUSA-N |
| Density | 1.086g/cm3 (Cal.) |
|---|---|
| Boiling point | 298.667°C at 760 mmHg (Cal.) |
| Flash point | 134.429°C (Cal.) |
| (1) | Martin R. Challand, Rebecca C. Driesener and Peter L. Roach. Radical S-adenosylmethionine enzymes: Mechanism, control and function, Nat. Prod. Rep., 2011, 28, 1696. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Desosamine |