Online Database of Chemicals from Around the World
|
CAS#: 58324-08-6 Product: (22S)-17,23,27-Trihydroxy-22,26-Epoxyergosta-2,5,24-Triene-1,26-Dione No suppilers available for the product. |
| Name | (22S)-17,23,27-Trihydroxy-22,26-Epoxyergosta-2,5,24-Triene-1,26-Dione |
|---|---|
| Synonyms | withanolide Q |
| Molecular Structure |  |
| Molecular Formula | C28H38O6 |
| Molecular Weight | 470.60 |
| CAS Registry Number | 58324-08-6 |
| SMILES | O=C4/C=C\C\C5=C\C[C@@H]2[C@H](CC[C@]1(C)[C@](O)(CC[C@H]12)[C@H](C)[C@@H]3OC(=O)C(\CO)=C(\C)C3O)[C@@]45C |
| InChI | 1S/C28H38O6/c1-15-19(14-29)25(32)34-24(23(15)31)16(2)28(33)13-11-20-18-9-8-17-6-5-7-22(30)27(17,4)21(18)10-12-26(20,28)3/h5,7-8,16,18,20-21,23-24,29,31,33H,6,9-14H2,1-4H3/t16-,18+,20+,21+,23?,24+,26+,27+,28+/m1/s1 |
| InChIKey | RCYHJRHAKWAKRC-BOERBOERSA-N |
| Density | 1.275g/cm3 (Cal.) |
|---|---|
| Boiling point | 692.467°C at 760 mmHg (Cal.) |
| Flash point | 229.846°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (22S)-17,23,27-Trihydroxy-22,26-Epoxyergosta-2,5,24-Triene-1,26-Dione |