|
CAS#: 58344-43-7 Product: 1-(4-Methoxyphenyl)-4,4-Dimethyl-1-Penten-3-Ol No suppilers available for the product. |
| Name | 1-(4-Methoxyphenyl)-4,4-Dimethyl-1-Penten-3-Ol |
|---|---|
| Synonyms | (E)-1-(4-Methoxyphenyl)-4,4-Dimethyl-Pent-1-En-3-Ol; 1-Penten-3-Ol, 4,4-Dimethyl-1-(4-Methoxyphenyl)-; 4,4-Dimethyl-1-(4-Methoxyphenyl)-1-Penten-3-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 |
| CAS Registry Number | 58344-43-7 |
| SMILES | C1=CC(=CC=C1\C=C\C(C(C)(C)C)O)OC |
| InChI | 1S/C14H20O2/c1-14(2,3)13(15)10-7-11-5-8-12(16-4)9-6-11/h5-10,13,15H,1-4H3/b10-7+ |
| InChIKey | DIVNQNKYYURXIK-JXMROGBWSA-N |
| Density | 1.009g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.284°C at 760 mmHg (Cal.) |
| Flash point | 147.793°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Methoxyphenyl)-4,4-Dimethyl-1-Penten-3-Ol |