|
CAS#: 58369-03-2 Product: 3-Methylanthra[1,2-c]Isoxazole-6,11-Dione No suppilers available for the product. |
| Name | 3-Methylanthra[1,2-c]Isoxazole-6,11-Dione |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C16H9NO3 |
| Molecular Weight | 263.25 |
| CAS Registry Number | 58369-03-2 |
| EINECS | 261-224-4 |
| SMILES | C2=CC1=C(ON=C1C3=C2C(C4=C(C3=O)C=CC=C4)=O)C |
| InChI | 1S/C16H9NO3/c1-8-9-6-7-12-13(14(9)17-20-8)16(19)11-5-3-2-4-10(11)15(12)18/h2-7H,1H3 |
| InChIKey | IGPNWOMDIBWEAT-UHFFFAOYSA-N |
| Density | 1.419g/cm3 (Cal.) |
|---|---|
| Boiling point | 489.808°C at 760 mmHg (Cal.) |
| Flash point | 250.027°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methylanthra[1,2-c]Isoxazole-6,11-Dione |