|
CAS#: 5887-93-4 Product: 1-(Butoxy-(Trichloromethyl)Phosphoryl)Oxybutane No suppilers available for the product. |
| Name | 1-(Butoxy-(Trichloromethyl)Phosphoryl)Oxybutane |
|---|---|
| Synonyms | Nsc22388 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H18Cl3O3P |
| Molecular Weight | 311.57 |
| CAS Registry Number | 5887-93-4 |
| SMILES | C(CCO[P](C(Cl)(Cl)Cl)(OCCCC)=O)C |
| InChI | 1S/C9H18Cl3O3P/c1-3-5-7-14-16(13,9(10,11)12)15-8-6-4-2/h3-8H2,1-2H3 |
| InChIKey | SUGMXDMMEJYWBB-UHFFFAOYSA-N |
| Density | 1.255g/cm3 (Cal.) |
|---|---|
| Boiling point | 307.127°C at 760 mmHg (Cal.) |
| Flash point | 183.303°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Butoxy-(Trichloromethyl)Phosphoryl)Oxybutane |