|
CAS#: 59222-96-7 Product: Ethyl o-Toluenesulphonate No suppilers available for the product. |
| Name | Ethyl o-Toluenesulphonate |
|---|---|
| Synonyms | 2-Methylbenzenesulfonic Acid Ethyl Ester; Ethyl O-Toluenesulphonate; Benzenesulfonic Acid, 2-Methyl-, Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C9H12O3S |
| Molecular Weight | 200.25 |
| CAS Registry Number | 59222-96-7 |
| EINECS | 261-666-8 |
| SMILES | C1=CC=CC(=C1[S](=O)(=O)OCC)C |
| InChI | 1S/C9H12O3S/c1-3-12-13(10,11)9-7-5-4-6-8(9)2/h4-7H,3H2,1-2H3 |
| InChIKey | LQCJGDKXBVRTKR-UHFFFAOYSA-N |
| Density | 1.175g/cm3 (Cal.) |
|---|---|
| Boiling point | 303.812°C at 760 mmHg (Cal.) |
| Flash point | 137.541°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl o-Toluenesulphonate |