|
CAS#: 59520-70-6 Product: 2,6-Dimethylclonidine No suppilers available for the product. |
| Name | 2,6-Dimethylclonidine |
|---|---|
| Synonyms | 4,5-Dihydro-1H-Imidazol-2-Yl-(2,6-Dimethylphenyl)Amine Hydrochloride; 2,6-Dimethyl Clonidine; 2,6-Dimethylclonidine |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16ClN3 |
| Molecular Weight | 225.72 |
| CAS Registry Number | 59520-70-6 |
| SMILES | [H+].C1=CC=C(C(=C1C)NC2=NCCN2)C.[Cl-] |
| InChI | 1S/C11H15N3.ClH/c1-8-4-3-5-9(2)10(8)14-11-12-6-7-13-11;/h3-5H,6-7H2,1-2H3,(H2,12,13,14);1H |
| InChIKey | YEMZMTCQUDSNQU-UHFFFAOYSA-N |
| Boiling point | 290°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 129.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Dimethylclonidine |