|
CAS#: 5980-94-9 Product: Phenylmercury No suppilers available for the product. |
| Name | Phenylmercury |
|---|---|
| Synonyms | Phenyl-Phenylsulfanyl-Mercury; Phenyl-(Phenylthio)Mercury; Nsc525234 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10HgS |
| Molecular Weight | 386.86 |
| CAS Registry Number | 5980-94-9 |
| SMILES | C1=CC=CC=C1[Hg]SC2=CC=CC=C2 |
| InChI | 1S/C6H6S.C6H5.Hg/c7-6-4-2-1-3-5-6;1-2-4-6-5-3-1;/h1-5,7H;1-5H;/q;;+1/p-1 |
| InChIKey | BXABFRUEXUYPJR-UHFFFAOYSA-M |
| Boiling point | 169.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 50.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenylmercury |