|
CAS#: 5982-23-0 Product: 3-(2-Carboxybenzyl)Isocoumarin No suppilers available for the product. |
| Name | 3-(2-Carboxybenzyl)Isocoumarin |
|---|---|
| Synonyms | 2-[(1-Oxo-3-Isochromenyl)Methyl]Benzoic Acid; 2-[(1-Ketoisochromen-3-Yl)Methyl]Benzoic Acid; Alpha-(1-Oxo-1H-2-Benzopyran-3-Yl)-O-Toluic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C17H12O4 |
| Molecular Weight | 280.28 |
| CAS Registry Number | 5982-23-0 |
| SMILES | C2=C1C=C(OC(C1=CC=C2)=O)CC3=CC=CC=C3C(=O)O |
| InChI | 1S/C17H12O4/c18-16(19)14-7-3-1-5-11(14)9-13-10-12-6-2-4-8-15(12)17(20)21-13/h1-8,10H,9H2,(H,18,19) |
| InChIKey | GCFOLLWPQAGLCM-UHFFFAOYSA-N |
| Density | 1.361g/cm3 (Cal.) |
|---|---|
| Boiling point | 493.579°C at 760 mmHg (Cal.) |
| Flash point | 186.852°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2-Carboxybenzyl)Isocoumarin |