Online Database of Chemicals from Around the World
|
CAS#: 60312-95-0 Product: 1-(4'-Bromo(1,1'-biphenyl)-4-yl)-2-phenylethan-1-one No suppilers available for the product. |
| Name | 1-(4'-Bromo(1,1'-biphenyl)-4-yl)-2-phenylethan-1-one |
|---|---|
| Synonyms | 1-[4-(4-Bromophenyl)Phenyl]-2-Phenyl-Ethanone; 1-(4'-Bromo(1,1'-Biphenyl)-4-Yl)-2-Phenylethan-1-One |
| Molecular Structure |  |
| Molecular Formula | C20H15BrO |
| Molecular Weight | 351.24 |
| CAS Registry Number | 60312-95-0 |
| EINECS | 262-161-5 |
| SMILES | C2=C(C(CC1=CC=CC=C1)=O)C=CC(=C2)C3=CC=C(C=C3)Br |
| InChI | 1S/C20H15BrO/c21-19-12-10-17(11-13-19)16-6-8-18(9-7-16)20(22)14-15-4-2-1-3-5-15/h1-13H,14H2 |
| InChIKey | GHEGAIKOMWURQJ-UHFFFAOYSA-N |
| Density | 1.335g/cm3 (Cal.) |
|---|---|
| Boiling point | 475.847°C at 760 mmHg (Cal.) |
| Flash point | 53.062°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4'-Bromo(1,1'-biphenyl)-4-yl)-2-phenylethan-1-one |