|
CAS#: 60313-31-7 Product: 4-Bromo-4'-(1-Bromo-2-Phenylethyl)-1,1'-Biphenyl No suppilers available for the product. |
| Name | 4-Bromo-4'-(1-Bromo-2-Phenylethyl)-1,1'-Biphenyl |
|---|---|
| Synonyms | 1-(4-Bromophenyl)-4-(1-Bromo-2-Phenyl-Ethyl)Benzene; 4-Bromo-4'-(1-Bromo-2-Phenylethyl)-1,1'-Biphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C20H16Br2 |
| Molecular Weight | 416.15 |
| CAS Registry Number | 60313-31-7 |
| EINECS | 262-164-1 |
| SMILES | C2=C(C1=CC=C(Br)C=C1)C=CC(=C2)C(Br)CC3=CC=CC=C3 |
| InChI | 1S/C20H16Br2/c21-19-12-10-17(11-13-19)16-6-8-18(9-7-16)20(22)14-15-4-2-1-3-5-15/h1-13,20H,14H2 |
| InChIKey | SGBOLLXQHLREDZ-UHFFFAOYSA-N |
| Density | 1.495g/cm3 (Cal.) |
|---|---|
| Boiling point | 452.233°C at 760 mmHg (Cal.) |
| Flash point | 265.472°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Bromo-4'-(1-Bromo-2-Phenylethyl)-1,1'-Biphenyl |