|
CAS#: 605-44-7 Product: 2,7-Diaminoanthracene-9,10-Dione No suppilers available for the product. |
| Name | 2,7-Diaminoanthracene-9,10-Dione |
|---|---|
| Synonyms | 2,7-Diamino-9,10-Anthraquinone; 2,7-Diaminoanthrachinon [Czech]; 2,7-Diaminoanthraquinone |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.25 |
| CAS Registry Number | 605-44-7 |
| SMILES | C1=C(N)C=CC2=C1C(=O)C3=C(C2=O)C=CC(=C3)N |
| InChI | 1S/C14H10N2O2/c15-7-1-3-9-11(5-7)14(18)12-6-8(16)2-4-10(12)13(9)17/h1-6H,15-16H2 |
| InChIKey | KJNHYKBXQOSFJR-UHFFFAOYSA-N |
| Density | 1.456g/cm3 (Cal.) |
|---|---|
| Boiling point | 551.878°C at 760 mmHg (Cal.) |
| Flash point | 287.566°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,7-Diaminoanthracene-9,10-Dione |