|
CAS#: 6054-00-8 Product: 3(2H)-Isoflavene No suppilers available for the product. |
| Name | 3(2H)-Isoflavene |
|---|---|
| Synonyms | 2H-1-Benzopyran, 3-Phenyl-; Aids161762; Aids-161762 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12O |
| Molecular Weight | 208.26 |
| CAS Registry Number | 6054-00-8 |
| SMILES | C1=CC=CC3=C1C=C(C2=CC=CC=C2)CO3 |
| InChI | 1S/C15H12O/c1-2-6-12(7-3-1)14-10-13-8-4-5-9-15(13)16-11-14/h1-10H,11H2 |
| InChIKey | CNNBJLXLTIKXGJ-UHFFFAOYSA-N |
| Density | 1.139g/cm3 (Cal.) |
|---|---|
| Boiling point | 340.502°C at 760 mmHg (Cal.) |
| Flash point | 156.342°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3(2H)-Isoflavene |