Online Database of Chemicals from Around the World
|
CAS#: 6065-11-8 Product: 2-Nitro-2-Octene No suppilers available for the product. |
| Name | 2-Nitro-2-Octene |
|---|---|
| Synonyms | 2-Nitro-2-Octene; 2-Octene, 2-Nitro- |
| Molecular Structure |  |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 |
| CAS Registry Number | 6065-11-8 |
| SMILES | C(/C=C([N+]([O-])=O)/C)CCCC |
| InChI | 1S/C8H15NO2/c1-3-4-5-6-7-8(2)9(10)11/h7H,3-6H2,1-2H3/b8-7- |
| InChIKey | NZTMOLZHWRCTTI-FPLPWBNLSA-N |
| Density | 0.943g/cm3 (Cal.) |
|---|---|
| Boiling point | 228.283°C at 760 mmHg (Cal.) |
| Flash point | 83.766°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Nitro-2-Octene |