|
CAS#: 60842-45-7 Product: Desaspidin No suppilers available for the product. |
| Name | Desaspidin |
|---|---|
| Synonyms | 2-Butanoyl-4-[(3-Butanoyl-2,4-Dihydroxy-6-Methoxy-Phenyl)Methyl]-3,5-Dihydroxy-6,6-Dimethyl-Cyclohexa-2,4-Dien-1-One; 4-[[2,4-Dihydroxy-6-Methoxy-3-(1-Oxobutyl)Phenyl]Methyl]-3,5-Dihydroxy-6,6-Dimethyl-2-(1-Oxobutyl)-1-Cyclohexa-2,4-Dienone; 2-Butyryl-4-(3-Butyryl-2,4-Dihydroxy-6-Methoxy-Benzyl)-3,5-Dihydroxy-6,6-Dimethyl-Cyclohexa-2,4-Dien-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C24H30O8 |
| Molecular Weight | 446.50 |
| CAS Registry Number | 60842-45-7 (114-43-2) |
| SMILES | C1=C(O)C(=C(O)C(=C1OC)CC2=C(O)C(C(=O)C(=C2O)C(=O)CCC)(C)C)C(=O)CCC |
| InChI | 1S/C24H30O8/c1-6-8-14(25)18-16(27)11-17(32-5)12(20(18)28)10-13-21(29)19(15(26)9-7-2)23(31)24(3,4)22(13)30/h11,27-30H,6-10H2,1-5H3 |
| InChIKey | XDIZFCKCCMUFFG-UHFFFAOYSA-N |
| Density | 1.306g/cm3 (Cal.) |
|---|---|
| Boiling point | 630.776°C at 760 mmHg (Cal.) |
| Flash point | 211.271°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Desaspidin |