|
CAS#: 61090-86-6 Product: 3-Bromo-2-(Bromomethyl)-2-(Chloromethyl)Propyl Dichlorophosphate No suppilers available for the product. |
| Name | 3-Bromo-2-(Bromomethyl)-2-(Chloromethyl)Propyl Dichlorophosphate |
|---|---|
| Synonyms | 1-Bromo-2-(Bromomethyl)-2-(Chloromethyl)-3-Dichlorophosphoryloxy-Propane; 3-Bromo-2-(Bromomethyl)-2-(Chloromethyl)Propyl Dichlorophosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C5H8Br2Cl3O2P |
| Molecular Weight | 397.26 |
| CAS Registry Number | 61090-86-6 |
| EINECS | 262-600-0 |
| SMILES | C(Br)C(CBr)(CO[P](Cl)(Cl)=O)CCl |
| InChI | 1S/C5H8Br2Cl3O2P/c6-1-5(2-7,3-8)4-12-13(9,10)11/h1-4H2 |
| InChIKey | DGNNHZCRJJDYIF-UHFFFAOYSA-N |
| Density | 1.965g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.512°C at 760 mmHg (Cal.) |
| Flash point | 197.837°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Bromo-2-(Bromomethyl)-2-(Chloromethyl)Propyl Dichlorophosphate |