|
CAS#: 61090-94-6 Product: Dimethyl 4-cyanophenyl phosphate No suppilers available for the product. |
| Name | Dimethyl 4-cyanophenyl phosphate |
|---|---|
| Synonyms | Phosphoric Acid (4-Cyanophenyl) Dimethyl Ester; Dimethyl 4-Cyano-Phenyl Phosphate; Brn 2695900 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10NO4P |
| Molecular Weight | 227.16 |
| CAS Registry Number | 61090-94-6 |
| SMILES | C1=C(C=CC(=C1)C#N)O[P](=O)(OC)OC |
| InChI | 1S/C9H10NO4P/c1-12-15(11,13-2)14-9-5-3-8(7-10)4-6-9/h3-6H,1-2H3 |
| InChIKey | UYPOZCXBRKUQSO-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for Dimethyl 4-cyanophenyl phosphate |