Online Database of Chemicals from Around the World
|
CAS#: 611-48-3 Product: (1-Naphtyl)(2-Naphtyl)Methane No suppilers available for the product. |
| Name | (1-Naphtyl)(2-Naphtyl)Methane |
|---|---|
| Synonyms | 1-(2-Naphthylmethyl)Naphthalene; Methane, 1-Naphthyl-2-Naphthyl-; Naphthalene, 1-(2-Naphthalenylmethyl)- |
| Molecular Structure |  |
| Molecular Formula | C21H16 |
| Molecular Weight | 268.36 |
| CAS Registry Number | 611-48-3 |
| SMILES | C1=CC=C4C(=C1CC2=CC3=C(C=C2)C=CC=C3)C=CC=C4 |
| InChI | 1S/C21H16/c1-2-8-19-14-16(12-13-17(19)6-1)15-20-10-5-9-18-7-3-4-11-21(18)20/h1-14H,15H2 |
| InChIKey | GPCYJQRKJVLCBS-UHFFFAOYSA-N |
| Density | 1.132g/cm3 (Cal.) |
|---|---|
| Boiling point | 452.046°C at 760 mmHg (Cal.) |
| Flash point | 221.236°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1-Naphtyl)(2-Naphtyl)Methane |