|
CAS#: 61128-14-1 Product: Isobutylene-p-Methylstyrene Copolymer No suppilers available for the product. |
| Name | Isobutylene-p-Methylstyrene Copolymer |
|---|---|
| Synonyms | 2-Methylprop-1-Ene; 1-Methyl-4-Vinyl-Benzene; 2-Methylprop-1-Ene; 1-Methyl-4-Vinylbenzene; Isobutylene; 1-Methyl-4-Vinyl-Benzene |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 |
| CAS Registry Number | 61128-14-1 |
| SMILES | C1=C(C=CC(=C1)C)C=C.CC(=C)C |
| InChI | 1S/C9H10.C4H8/c1-3-9-6-4-8(2)5-7-9;1-4(2)3/h3-7H,1H2,2H3;1H2,2-3H3 |
| InChIKey | JBAUPCNQUQGXJT-UHFFFAOYSA-N |
| Boiling point | 172°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 48.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isobutylene-p-Methylstyrene Copolymer |