|
CAS#: 61131-60-0 Product: 3-(2-Nitro-1-Propenyl)Phenol No suppilers available for the product. |
| Name | 3-(2-Nitro-1-Propenyl)Phenol |
|---|---|
| Synonyms | M-(2-Nitro-1-Propenyl)Phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.18 |
| CAS Registry Number | 61131-60-0 |
| EINECS | 262-619-4 |
| SMILES | C1=C(C=CC=C1\C=C([N+](=O)[O-])/C)O |
| InChI | 1S/C9H9NO3/c1-7(10(12)13)5-8-3-2-4-9(11)6-8/h2-6,11H,1H3/b7-5+ |
| InChIKey | PSRIKSDCVRDVKZ-FNORWQNLSA-N |
| Density | 1.267g/cm3 (Cal.) |
|---|---|
| Boiling point | 343.309°C at 760 mmHg (Cal.) |
| Flash point | 152.911°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2-Nitro-1-Propenyl)Phenol |