|
CAS#: 612-03-3 Product: N-Methyl-N-(4-Methylphenyl)Acetamide No suppilers available for the product. |
| Name | N-Methyl-N-(4-Methylphenyl)Acetamide |
|---|---|
| Synonyms | N-Methyl-N-(4-Methylphenyl)Ethanamide; Nsc7647; P-Acetotoluidide, N-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 |
| CAS Registry Number | 612-03-3 |
| SMILES | C1=C(C=CC(=C1)C)N(C(=O)C)C |
| InChI | 1S/C10H13NO/c1-8-4-6-10(7-5-8)11(3)9(2)12/h4-7H,1-3H3 |
| InChIKey | ZMYCGFKAPZHNPC-UHFFFAOYSA-N |
| Density | 1.037g/cm3 (Cal.) |
|---|---|
| Boiling point | 263.615°C at 760 mmHg (Cal.) |
| Flash point | 113.123°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Methyl-N-(4-Methylphenyl)Acetamide |