Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 5-(Methylthio)-o-Anisic Acid |
|---|---|
| Synonyms | 2-Methoxy-5-Methylsulfanyl-Benzoic Acid; 2-Methoxy-5-(Methylthio)Benzoic Acid; 5-(Methylthio)-O-Anisic Acid |
| Molecular Structure |  |
| Molecular Formula | C9H10O3S |
| Molecular Weight | 198.24 |
| CAS Registry Number | 61694-97-1 |
| EINECS | 262-910-6 |
| SMILES | C1=C(SC)C=CC(=C1C(=O)O)OC |
| InChI | 1S/C9H10O3S/c1-12-8-4-3-6(13-2)5-7(8)9(10)11/h3-5H,1-2H3,(H,10,11) |
| InChIKey | QTKWJUXASAOROX-UHFFFAOYSA-N |
| Density | 1.291g/cm3 (Cal.) |
|---|---|
| Boiling point | 351.92°C at 760 mmHg (Cal.) |
| Flash point | 166.635°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(Methylthio)-o-Anisic Acid |