|
CAS#: 61888-63-9 Product: 4'-Chloro-5-Isobutoxy-3-Biphenylacetic Acid No suppilers available for the product. |
| Name | 4'-Chloro-5-Isobutoxy-3-Biphenylacetic Acid |
|---|---|
| Synonyms | 2-[3-(4-Chlorophenyl)-5-Isobutoxy-Phenyl]Acetic Acid; 2-[3-(4-Chlorophenyl)-5-Isobutoxyphenyl]Acetic Acid; 2-[3-(4-Chlorophenyl)-5-(2-Methylpropoxy)Phenyl]Ethanoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C18H19ClO3 |
| Molecular Weight | 318.80 |
| CAS Registry Number | 61888-63-9 |
| SMILES | C1=C(CC(O)=O)C=C(C=C1OCC(C)C)C2=CC=C(C=C2)Cl |
| InChI | 1S/C18H19ClO3/c1-12(2)11-22-17-8-13(9-18(20)21)7-15(10-17)14-3-5-16(19)6-4-14/h3-8,10,12H,9,11H2,1-2H3,(H,20,21) |
| InChIKey | TVPAJWGXBGUWSU-UHFFFAOYSA-N |
| Density | 1.189g/cm3 (Cal.) |
|---|---|
| Boiling point | 463.193°C at 760 mmHg (Cal.) |
| Flash point | 233.931°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4'-Chloro-5-Isobutoxy-3-Biphenylacetic Acid |