|
CAS#: 6204-42-8 Product: cis-2-(Bromomethyl)-1,3-Dioxolane-4-Methanol No suppilers available for the product. |
| Name | cis-2-(Bromomethyl)-1,3-Dioxolane-4-Methanol |
|---|---|
| Synonyms | Cis-2-(Bromomethyl)-1,3-Dioxolane-4-Methanol |
| Molecular Structure | ![]() |
| Molecular Formula | C5H9BrO3 |
| Molecular Weight | 197.03 |
| CAS Registry Number | 6204-42-8 |
| EINECS | 228-272-8 |
| SMILES | [C@H]1(O[C@@H](CO1)CO)CBr |
| InChI | 1S/C5H9BrO3/c6-1-5-8-3-4(2-7)9-5/h4-5,7H,1-3H2/t4-,5+/m1/s1 |
| InChIKey | ZSLVLMWYSIERCN-UHNVWZDZSA-N |
| Density | 1.594g/cm3 (Cal.) |
|---|---|
| Boiling point | 266.273°C at 760 mmHg (Cal.) |
| Flash point | 114.838°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for cis-2-(Bromomethyl)-1,3-Dioxolane-4-Methanol |