Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | (Z)-4-[(Benzyloxy)Methyl]-2-(Bromomethyl)-1,3-Dioxolane |
|---|---|
| Synonyms | (2S,4R)-4-(Benzyloxymethyl)-2-(Bromomethyl)-1,3-Dioxolane; (Z)-4-((Benzyloxy)Methyl)-2-(Bromomethyl)-1,3-Dioxolane |
| Molecular Structure | ![CAS#: 6204-40-6, (Z)-4-[(Benzyloxy)Methyl]-2-(Bromomethyl)-1,3-Dioxolane](/moreStructures/6204-40-6.gif) |
| Molecular Formula | C12H15BrO3 |
| Molecular Weight | 287.15 |
| CAS Registry Number | 6204-40-6 |
| EINECS | 228-270-7 |
| SMILES | [C@H]1(O[C@@H](CO1)COCC2=CC=CC=C2)CBr |
| InChI | 1S/C12H15BrO3/c13-6-12-15-9-11(16-12)8-14-7-10-4-2-1-3-5-10/h1-5,11-12H,6-9H2/t11-,12+/m1/s1 |
| InChIKey | XRDOVVFGDQXDTR-NEPJUHHUSA-N |
| Density | 1.369g/cm3 (Cal.) |
|---|---|
| Boiling point | 360.749°C at 760 mmHg (Cal.) |
| Flash point | 147.43°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (Z)-4-[(Benzyloxy)Methyl]-2-(Bromomethyl)-1,3-Dioxolane |