|
CAS#: 62047-27-2 Product: 1-[(2-Chloroethyl)Thio]-2-Nitrobenzene No suppilers available for the product. |
| Name | 1-[(2-Chloroethyl)Thio]-2-Nitrobenzene |
|---|---|
| Synonyms | 1-(2-Chloroethylsulfanyl)-2-Nitro-Benzene; 1-(2-Chloroethylthio)-2-Nitrobenzene; 1-(2-Chloroethylthio)-2-Nitro-Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8ClNO2S |
| Molecular Weight | 217.67 |
| CAS Registry Number | 62047-27-2 |
| EINECS | 263-390-3 |
| SMILES | C1=CC=CC(=C1SCCCl)[N+]([O-])=O |
| InChI | 1S/C8H8ClNO2S/c9-5-6-13-8-4-2-1-3-7(8)10(11)12/h1-4H,5-6H2 |
| InChIKey | NDGBEMZDTZFYFI-UHFFFAOYSA-N |
| Density | 1.356g/cm3 (Cal.) |
|---|---|
| Boiling point | 319.403°C at 760 mmHg (Cal.) |
| Flash point | 146.97°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(2-Chloroethyl)Thio]-2-Nitrobenzene |