Online Database of Chemicals from Around the World
|
CAS#: 62096-81-5 Product: 4-(3,4-Dimethoxybenzoyl)Oxolan-2-One No suppilers available for the product. |
| Name | 4-(3,4-Dimethoxybenzoyl)Oxolan-2-One |
|---|---|
| Synonyms | 4-(3,4-Dimethoxybenzoyl)Tetrahydrofuran-2-One; 4-[(3,4-Dimethoxyphenyl)-Oxomethyl]-2-Tetrahydrofuranone; 4-(3,4-Dimethoxyphenyl)Carbonyloxolan-2-One |
| Molecular Structure |  |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 |
| CAS Registry Number | 62096-81-5 |
| SMILES | C2=C(C(C1COC(C1)=O)=O)C=CC(=C2OC)OC |
| InChI | 1S/C13H14O5/c1-16-10-4-3-8(5-11(10)17-2)13(15)9-6-12(14)18-7-9/h3-5,9H,6-7H2,1-2H3 |
| InChIKey | MKWYWISNPJGVLR-UHFFFAOYSA-N |
| Density | 1.243g/cm3 (Cal.) |
|---|---|
| Boiling point | 450.844°C at 760 mmHg (Cal.) |
| Flash point | 269.582°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-(3,4-Dimethoxybenzoyl)Oxolan-2-One |